C25H32N4O6 — CID 89412968
tert-butyl-[[4-[4-[[1-(hydroxyamino)-3-(methylamino)-1,3-dioxopropan-2-yl]-methylcarbamoyl]phenyl]-2-methylphenyl]methyl]carbamic acid (PubChem CID 89412968) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is tert-butyl-[[4-[4-[[1-(hydroxyamino)-3-(methylamino)-1,3-dioxopropan-2-yl]-methylcarbamoyl]phenyl]-2-methylphenyl]methyl]carbamic acid.
| Compound Name | tert-butyl-[[4-[4-[[1-(hydroxyamino)-3-(methylamino)-1,3-dioxopropan-2-yl]-methylcarbamoyl]phenyl]-2-methylphenyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 89412968 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | tert-butyl-[[4-[4-[[1-(hydroxyamino)-3-(methylamino)-1,3-dioxopropan-2-yl]-methylcarbamoyl]phenyl]-2-methylphenyl]methyl]carbamic acid |
| SMILES | CNC(=O)C(C(=O)NO)N(C)C(=O)c1ccc(-c2ccc(CN(C(=O)O)C(C)(C)C)c(C)c2)cc1 |
| InChI | InChI=1S/C25H32N4O6/c1-15-13-18(11-12-19(15)14-29(24(33)34)25(2,3)4)16-7-9-17(10-8-16)23(32)28(6)20(21(30)26-5)22(31)27-35/h7-13,20,35H,14H2,1-6H3,(H,26,30)(H,27,31)(H,33,34) |
| InChIKey | CSXTUGSMBQYIAS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|