C22H26N4O4 — CID 89413306
(2S)-N-hydroxy-N',2-dimethyl-2-[methyl-[4-(1-methyl-2,3-dihydroindol-5-yl)benzoyl]amino]propanediamide (PubChem CID 89413306) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is (2S)-N-hydroxy-N',2-dimethyl-2-[methyl-[4-(1-methyl-2,3-dihydroindol-5-yl)benzoyl]amino]propanediamide.
| Compound Name | (2S)-N-hydroxy-N',2-dimethyl-2-[methyl-[4-(1-methyl-2,3-dihydroindol-5-yl)benzoyl]amino]propanediamide |
|---|---|
| PubChem CID | 89413306 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (2S)-N-hydroxy-N',2-dimethyl-2-[methyl-[4-(1-methyl-2,3-dihydroindol-5-yl)benzoyl]amino]propanediamide |
| SMILES | CNC(=O)[C@@](C)(C(=O)NO)N(C)C(=O)c1ccc(-c2ccc3c(c2)CCN3C)cc1 |
| InChI | InChI=1S/C22H26N4O4/c1-22(20(28)23-2,21(29)24-30)26(4)19(27)15-7-5-14(6-8-15)16-9-10-18-17(13-16)11-12-25(18)3/h5-10,13,30H,11-12H2,1-4H3,(H,23,28)(H,24,29)/t22-/m0/s1 |
| InChIKey | HKVPLLVTEFHKRF-QFIPXVFZSA-N |
| XLogP | 1.43 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|