C13H14F3N3O5 — CID 89413412
N-hydroxy-N'-methyl-2-[methyl-[4-(trifluoromethoxy)benzoyl]amino]propanediamide (PubChem CID 89413412) has the molecular formula C13H14F3N3O5 and a molecular weight of 349.27 g/mol. Its IUPAC name is N-hydroxy-N'-methyl-2-[methyl-[4-(trifluoromethoxy)benzoyl]amino]propanediamide.
| Compound Name | N-hydroxy-N'-methyl-2-[methyl-[4-(trifluoromethoxy)benzoyl]amino]propanediamide |
|---|---|
| PubChem CID | 89413412 |
| Molecular Formula | C13H14F3N3O5 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-hydroxy-N'-methyl-2-[methyl-[4-(trifluoromethoxy)benzoyl]amino]propanediamide |
| SMILES | CNC(=O)C(C(=O)NO)N(C)C(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3N3O5/c1-17-10(20)9(11(21)18-23)19(2)12(22)7-3-5-8(6-4-7)24-13(14,15)16/h3-6,9,23H,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | UFOBPRLGDHXMBG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|