About 1-chloropropyl (2-fluorocyclohexyl) carbonate
1-chloropropyl (2-fluorocyclohexyl) carbonate (PubChem CID 89413864) has the molecular formula C10H16ClFO3
and a molecular weight of 238.69 g/mol. Its IUPAC name is 1-chloropropyl (2-fluorocyclohexyl) carbonate.
Molecular Properties
| Compound Name | 1-chloropropyl (2-fluorocyclohexyl) carbonate |
| PubChem CID | 89413864 |
| Molecular Formula | C10H16ClFO3 |
| Molecular Weight | 238.69 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-chloropropyl (2-fluorocyclohexyl) carbonate |
| SMILES | CCC(Cl)OC(=O)OC1CCCCC1F |
| InChI | InChI=1S/C10H16ClFO3/c1-2-9(11)15-10(13)14-8-6-4-3-5-7(8)12/h7-9H,2-6H2,1H3 |
| InChIKey | GZANVXYGNKOYJW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.69 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropropyl (2-fluorocyclohexyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropropyl (2-fluorocyclohexyl) carbonate?
The IUPAC name of 1-chloropropyl (2-fluorocyclohexyl) carbonate (CID 89413864) is 1-chloropropyl (2-fluorocyclohexyl) carbonate.
What is the SMILES notation for 1-chloropropyl (2-fluorocyclohexyl) carbonate?
The canonical SMILES for 1-chloropropyl (2-fluorocyclohexyl) carbonate is CCC(Cl)OC(=O)OC1CCCCC1F.
What is the InChIKey of 1-chloropropyl (2-fluorocyclohexyl) carbonate?
The InChIKey is GZANVXYGNKOYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClFO3/c1-2-9(11)15-10(13)14-8-6-4-3-5-7(8)12/h7-9H,2-6H2,1H3.
What are the key properties of 1-chloropropyl (2-fluorocyclohexyl) carbonate?
1-chloropropyl (2-fluorocyclohexyl) carbonate has a molecular weight of 238.69 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropropyl (2-fluorocyclohexyl) carbonate is sourced from PubChem (CID 89413864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).