About trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate
trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate (PubChem CID 89414065) has the molecular formula C20H19F3O5S
and a molecular weight of 428.43 g/mol. Its IUPAC name is trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate |
| PubChem CID | 89414065 |
| Molecular Formula | C20H19F3O5S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1CC[C@H](OS(=O)(=O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C20H19F3O5S/c21-20(22,23)16-7-10-18(11-8-16)29(25,26)28-17-9-6-15(12-17)19(24)27-13-14-4-2-1-3-5-14/h1-5,7-8,10-11,15,17H,6,9,12-13H2/t15-,17-/m0/s1 |
| InChIKey | SRCPIXAMTDBGFN-RDJZCZTQSA-N |
| XLogP | 4.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate?
The IUPAC name of trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate (CID 89414065) is trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate.
What is the SMILES notation for trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate?
The canonical SMILES for trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate is O=C(OCc1ccccc1)[C@H]1CC[C@H](OS(=O)(=O)c2ccc(C(F)(F)F)cc2)C1.
What is the InChIKey of trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate?
The InChIKey is SRCPIXAMTDBGFN-RDJZCZTQSA-N. The full InChI is InChI=1S/C20H19F3O5S/c21-20(22,23)16-7-10-18(11-8-16)29(25,26)28-17-9-6-15(12-17)19(24)27-13-14-4-2-1-3-5-14/h1-5,7-8,10-11,15,17H,6,9,12-13H2/t15-,17-/m0/s1.
What are the key properties of trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate?
trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate has a molecular weight of 428.43 g/mol, XLogP of 4.32, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trans-benzyl (1S,3S)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate is sourced from PubChem (CID 89414065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).