About 1-fluoroethyl ethylsulfanylformate
1-fluoroethyl ethylsulfanylformate (PubChem CID 89415264) has the molecular formula C5H9FO2S
and a molecular weight of 152.19 g/mol. Its IUPAC name is 1-fluoroethyl ethylsulfanylformate.
Molecular Properties
| Compound Name | 1-fluoroethyl ethylsulfanylformate |
| PubChem CID | 89415264 |
| Molecular Formula | C5H9FO2S |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 1-fluoroethyl ethylsulfanylformate |
| SMILES | CCSC(=O)OC(C)F |
| InChI | InChI=1S/C5H9FO2S/c1-3-9-5(7)8-4(2)6/h4H,3H2,1-2H3 |
| InChIKey | GEOIMNSALTUQMC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroethyl ethylsulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroethyl ethylsulfanylformate?
The IUPAC name of 1-fluoroethyl ethylsulfanylformate (CID 89415264) is 1-fluoroethyl ethylsulfanylformate.
What is the SMILES notation for 1-fluoroethyl ethylsulfanylformate?
The canonical SMILES for 1-fluoroethyl ethylsulfanylformate is CCSC(=O)OC(C)F.
What is the InChIKey of 1-fluoroethyl ethylsulfanylformate?
The InChIKey is GEOIMNSALTUQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FO2S/c1-3-9-5(7)8-4(2)6/h4H,3H2,1-2H3.
What are the key properties of 1-fluoroethyl ethylsulfanylformate?
1-fluoroethyl ethylsulfanylformate has a molecular weight of 152.19 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroethyl ethylsulfanylformate is sourced from PubChem (CID 89415264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).