About 4H-benzo[7]annulen-7-ol
4H-benzo[7]annulen-7-ol (PubChem CID 89415446) has the molecular formula C11H10O
and a molecular weight of 158.20 g/mol. Its IUPAC name is 4H-benzo[7]annulen-7-ol.
Molecular Properties
| Compound Name | 4H-benzo[7]annulen-7-ol |
| PubChem CID | 89415446 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 4H-benzo[7]annulen-7-ol |
| SMILES | OC1=CC=C2CC=CC=C2C=C1 |
| InChI | InChI=1S/C11H10O/c12-11-7-5-9-3-1-2-4-10(9)6-8-11/h1-3,5-8,12H,4H2 |
| InChIKey | YRDJETSPUQKEOW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4H-benzo[7]annulen-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-benzo[7]annulen-7-ol?
The IUPAC name of 4H-benzo[7]annulen-7-ol (CID 89415446) is 4H-benzo[7]annulen-7-ol.
What is the SMILES notation for 4H-benzo[7]annulen-7-ol?
The canonical SMILES for 4H-benzo[7]annulen-7-ol is OC1=CC=C2CC=CC=C2C=C1.
What is the InChIKey of 4H-benzo[7]annulen-7-ol?
The InChIKey is YRDJETSPUQKEOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O/c12-11-7-5-9-3-1-2-4-10(9)6-8-11/h1-3,5-8,12H,4H2.
What are the key properties of 4H-benzo[7]annulen-7-ol?
4H-benzo[7]annulen-7-ol has a molecular weight of 158.20 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-benzo[7]annulen-7-ol is sourced from PubChem (CID 89415446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).