C34H42O10Si — CID 89415460
4-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-6,7,8-trimethoxy-3-(3,4,5-trimethoxyphenyl)chromen-2-one (PubChem CID 89415460) has the molecular formula C34H42O10Si and a molecular weight of 638.79 g/mol. Its IUPAC name is 4-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-6,7,8-trimethoxy-3-(3,4,5-trimethoxyphenyl)chromen-2-one.
| Compound Name | 4-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-6,7,8-trimethoxy-3-(3,4,5-trimethoxyphenyl)chromen-2-one |
|---|---|
| PubChem CID | 89415460 |
| Molecular Formula | C34H42O10Si |
| Molecular Weight | 638.79 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | 4-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-6,7,8-trimethoxy-3-(3,4,5-trimethoxyphenyl)chromen-2-one |
| SMILES | COc1ccc(-c2c(-c3cc(OC)c(OC)c(OC)c3)c(=O)oc3c(OC)c(OC)c(OC)cc23)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H42O10Si/c1-34(2,3)45(11,12)44-23-15-19(13-14-22(23)36-4)27-21-18-26(39-7)31(41-9)32(42-10)29(21)43-33(35)28(27)20-16-24(37-5)30(40-8)25(17-20)38-6/h13-18H,1-12H3 |
| InChIKey | GNKPDQZOJKXEEQ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 104.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.79 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|