C18H21N — CID 89416119
[4-[4-(2-methylbutyl)phenyl]phenyl]methanimine (PubChem CID 89416119) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is [4-[4-(2-methylbutyl)phenyl]phenyl]methanimine.
| Compound Name | [4-[4-(2-methylbutyl)phenyl]phenyl]methanimine |
|---|---|
| PubChem CID | 89416119 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | [4-[4-(2-methylbutyl)phenyl]phenyl]methanimine |
| SMILES | [H]/N=C/c1ccc(-c2ccc(CC(C)CC)cc2)cc1 |
| InChI | InChI=1S/C18H21N/c1-3-14(2)12-15-4-8-17(9-5-15)18-10-6-16(13-19)7-11-18/h4-11,13-14,19H,3,12H2,1-2H3/b19-13+ |
| InChIKey | OHULRPCCYMOEFT-CPNJWEJPSA-N |
| XLogP | 4.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|