C16H33N — CID 89416132
3-(2,2-dimethylpropyl)-4,4,6,6-tetramethylheptan-2-imine (PubChem CID 89416132) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-4,4,6,6-tetramethylheptan-2-imine.
| Compound Name | 3-(2,2-dimethylpropyl)-4,4,6,6-tetramethylheptan-2-imine |
|---|---|
| PubChem CID | 89416132 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-4,4,6,6-tetramethylheptan-2-imine |
| SMILES | [H]/N=C(\C)C(CC(C)(C)C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H33N/c1-12(17)13(10-14(2,3)4)16(8,9)11-15(5,6)7/h13,17H,10-11H2,1-9H3/b17-12+ |
| InChIKey | AAZJPKUGICWOHJ-SFQUDFHCSA-N |
| XLogP | 5.54 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|