C12H8Br2N4 — CID 89416404
3-bromo-6-(4-bromo-5,6-diiminocyclohexa-1,3-dien-1-yl)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 89416404) has the molecular formula C12H8Br2N4 and a molecular weight of 368.03 g/mol. Its IUPAC name is 3-bromo-6-(4-bromo-5,6-diiminocyclohexa-1,3-dien-1-yl)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 3-bromo-6-(4-bromo-5,6-diiminocyclohexa-1,3-dien-1-yl)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 89416404 |
| Molecular Formula | C12H8Br2N4 |
| Molecular Weight | 368.03 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | 3-bromo-6-(4-bromo-5,6-diiminocyclohexa-1,3-dien-1-yl)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1\C(Br)=CC=C(C2=CC=C(Br)C(=N\[H])/C2=N\[H])\C1=N\[H] |
| InChI | InChI=1S/C12H8Br2N4/c13-7-3-1-5(9(15)11(7)17)6-2-4-8(14)12(18)10(6)16/h1-4,15-18H/b15-9-,16-10-,17-11+,18-12+ |
| InChIKey | CWXQAGJGFNXBKW-HWXVKKTHSA-N |
| XLogP | 3.50 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.03 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|