C11H17N3O — CID 89416432
(E,2R)-2-prop-2-enyl-3-(1,2,4-triazol-1-ylmethyl)pent-3-en-1-ol (PubChem CID 89416432) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is (E,2R)-2-prop-2-enyl-3-(1,2,4-triazol-1-ylmethyl)pent-3-en-1-ol.
| Compound Name | (E,2R)-2-prop-2-enyl-3-(1,2,4-triazol-1-ylmethyl)pent-3-en-1-ol |
|---|---|
| PubChem CID | 89416432 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (E,2R)-2-prop-2-enyl-3-(1,2,4-triazol-1-ylmethyl)pent-3-en-1-ol |
| SMILES | C=CC[C@@H](CO)/C(=C\C)Cn1cncn1 |
| InChI | InChI=1S/C11H17N3O/c1-3-5-11(7-15)10(4-2)6-14-9-12-8-13-14/h3-4,8-9,11,15H,1,5-7H2,2H3/b10-4-/t11-/m0/s1 |
| InChIKey | PUQJIZHINZJSFS-FGUAACIASA-N |
| XLogP | 1.41 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|