About (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one
(Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one (PubChem CID 89416443) has the molecular formula C7H10F2N2O
and a molecular weight of 176.17 g/mol. Its IUPAC name is (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one.
Molecular Properties
| Compound Name | (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one |
| PubChem CID | 89416443 |
| Molecular Formula | C7H10F2N2O |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one |
| SMILES | [H]/N=C/C(F)[C@@H](N)/C=C\C(=O)CF |
| InChI | InChI=1S/C7H10F2N2O/c8-3-5(12)1-2-7(11)6(9)4-10/h1-2,4,6-7,10H,3,11H2/b2-1-,10-4+/t6?,7-/m0/s1 |
| InChIKey | DUUADQGMPFCIIX-JTCIEBBTSA-N |
| XLogP | 0.40 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one?
The IUPAC name of (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one (CID 89416443) is (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one.
What is the SMILES notation for (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one?
The canonical SMILES for (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one is [H]/N=C/C(F)[C@@H](N)/C=C\C(=O)CF.
What is the InChIKey of (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one?
The InChIKey is DUUADQGMPFCIIX-JTCIEBBTSA-N. The full InChI is InChI=1S/C7H10F2N2O/c8-3-5(12)1-2-7(11)6(9)4-10/h1-2,4,6-7,10H,3,11H2/b2-1-,10-4+/t6?,7-/m0/s1.
What are the key properties of (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one?
(Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one has a molecular weight of 176.17 g/mol, XLogP of 0.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,5S)-5-amino-1,6-difluoro-7-iminohept-3-en-2-one is sourced from PubChem (CID 89416443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).