C13H15F2N3O — CID 89416468
5-fluoro-2-[(3E,5Z)-4-fluoro-2-methylocta-3,5,7-trienoxy]pyrimidin-4-amine (PubChem CID 89416468) has the molecular formula C13H15F2N3O and a molecular weight of 267.28 g/mol. Its IUPAC name is 5-fluoro-2-[(3E,5Z)-4-fluoro-2-methylocta-3,5,7-trienoxy]pyrimidin-4-amine.
| Compound Name | 5-fluoro-2-[(3E,5Z)-4-fluoro-2-methylocta-3,5,7-trienoxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 89416468 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 5-fluoro-2-[(3E,5Z)-4-fluoro-2-methylocta-3,5,7-trienoxy]pyrimidin-4-amine |
| SMILES | C=C/C=C\C(F)=C/C(C)COc1ncc(F)c(N)n1 |
| InChI | InChI=1S/C13H15F2N3O/c1-3-4-5-10(14)6-9(2)8-19-13-17-7-11(15)12(16)18-13/h3-7,9H,1,8H2,2H3,(H2,16,17,18)/b5-4-,10-6+ |
| InChIKey | KKWGOBMKZJMFRC-VWJYOPCBSA-N |
| XLogP | 2.81 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|