C7H9FIN — CID 89416505
(3Z,5E)-5-fluoro-N-iodohepta-1,3,5-trien-2-amine (PubChem CID 89416505) has the molecular formula C7H9FIN and a molecular weight of 253.06 g/mol. Its IUPAC name is (3Z,5E)-5-fluoro-N-iodohepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-5-fluoro-N-iodohepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 89416505 |
| Molecular Formula | C7H9FIN |
| Molecular Weight | 253.06 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | (3Z,5E)-5-fluoro-N-iodohepta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(F)=C/C)NI |
| InChI | InChI=1S/C7H9FIN/c1-3-7(8)5-4-6(2)10-9/h3-5,10H,2H2,1H3/b5-4-,7-3+ |
| InChIKey | VNZYXGUTRJAIIR-SBYNAHCQSA-N |
| XLogP | 2.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.06 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|