C13H16FN3O — CID 89416517
2-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienoxy]-5-fluoropyrimidin-4-amine (PubChem CID 89416517) has the molecular formula C13H16FN3O and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienoxy]-5-fluoropyrimidin-4-amine.
| Compound Name | 2-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienoxy]-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 89416517 |
| Molecular Formula | C13H16FN3O |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienoxy]-5-fluoropyrimidin-4-amine |
| SMILES | C=C(C)/C=C\C(=C/C)COc1ncc(F)c(N)n1 |
| InChI | InChI=1S/C13H16FN3O/c1-4-10(6-5-9(2)3)8-18-13-16-7-11(14)12(15)17-13/h4-7H,2,8H2,1,3H3,(H2,15,16,17)/b6-5-,10-4- |
| InChIKey | DZJHKNXFPPVDJT-ZQWSEWHOSA-N |
| XLogP | 2.66 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|