C6H11FN2 — CID 89416521
(2E,4E)-5-fluorohexa-2,4-diene-1,4-diamine (PubChem CID 89416521) has the molecular formula C6H11FN2 and a molecular weight of 130.17 g/mol. Its IUPAC name is (2E,4E)-5-fluorohexa-2,4-diene-1,4-diamine.
| Compound Name | (2E,4E)-5-fluorohexa-2,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 89416521 |
| Molecular Formula | C6H11FN2 |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | (2E,4E)-5-fluorohexa-2,4-diene-1,4-diamine |
| SMILES | C/C(F)=C(N)/C=C/CN |
| InChI | InChI=1S/C6H11FN2/c1-5(7)6(9)3-2-4-8/h2-3H,4,8-9H2,1H3/b3-2+,6-5+ |
| InChIKey | PPYIMHPCCWGERE-ZIMISOLQSA-N |
| XLogP | 0.66 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|