About (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol
(Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol (PubChem CID 89416552) has the molecular formula C11H18F2O2
and a molecular weight of 220.26 g/mol. Its IUPAC name is (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol.
Molecular Properties
| Compound Name | (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol |
| PubChem CID | 89416552 |
| Molecular Formula | C11H18F2O2 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol |
| SMILES | C/C=C(\C=C/C(C)OCC(C)(F)F)CO |
| InChI | InChI=1S/C11H18F2O2/c1-4-10(7-14)6-5-9(2)15-8-11(3,12)13/h4-6,9,14H,7-8H2,1-3H3/b6-5-,10-4+ |
| InChIKey | IFBIIHAZUZUHRV-QYONPMAVSA-N |
| XLogP | 2.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol?
The IUPAC name of (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol (CID 89416552) is (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol.
What is the SMILES notation for (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol?
The canonical SMILES for (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol is C/C=C(\C=C/C(C)OCC(C)(F)F)CO.
What is the InChIKey of (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol?
The InChIKey is IFBIIHAZUZUHRV-QYONPMAVSA-N. The full InChI is InChI=1S/C11H18F2O2/c1-4-10(7-14)6-5-9(2)15-8-11(3,12)13/h4-6,9,14H,7-8H2,1-3H3/b6-5-,10-4+.
What are the key properties of (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol?
(Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol has a molecular weight of 220.26 g/mol, XLogP of 2.54, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2E)-5-(2,2-difluoropropoxy)-2-ethylidenehex-3-en-1-ol is sourced from PubChem (CID 89416552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).