About N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide
N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide (PubChem CID 89417425) has the molecular formula C16H31NO2
and a molecular weight of 269.43 g/mol. Its IUPAC name is N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide |
| PubChem CID | 89417425 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)N(C(=O)CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H31NO2/c1-14(2,3)10-12(18)17(16(7,8)9)13(19)11-15(4,5)6/h10-11H2,1-9H3 |
| InChIKey | GJHCPBRGWHMLAK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide?
The IUPAC name of N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide (CID 89417425) is N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide.
What is the SMILES notation for N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide?
The canonical SMILES for N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide is CC(C)(C)CC(=O)N(C(=O)CC(C)(C)C)C(C)(C)C.
What is the InChIKey of N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide?
The InChIKey is GJHCPBRGWHMLAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO2/c1-14(2,3)10-12(18)17(16(7,8)9)13(19)11-15(4,5)6/h10-11H2,1-9H3.
What are the key properties of N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide?
N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide has a molecular weight of 269.43 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-(3,3-dimethylbutanoyl)-3,3-dimethylbutanamide is sourced from PubChem (CID 89417425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).