About 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate
3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate (PubChem CID 89417553) has the molecular formula C17H30O2
and a molecular weight of 266.42 g/mol. Its IUPAC name is 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate.
Molecular Properties
| Compound Name | 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate |
| PubChem CID | 89417553 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate |
| SMILES | CCC(C)C(C)(CC)OC(=O)C(C=C(C)C)=C(C)C |
| InChI | InChI=1S/C17H30O2/c1-9-14(7)17(8,10-2)19-16(18)15(13(5)6)11-12(3)4/h11,14H,9-10H2,1-8H3 |
| InChIKey | CLUYAGDEOXTZPK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate?
The IUPAC name of 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate (CID 89417553) is 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate.
What is the SMILES notation for 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate?
The canonical SMILES for 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate is CCC(C)C(C)(CC)OC(=O)C(C=C(C)C)=C(C)C.
What is the InChIKey of 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate?
The InChIKey is CLUYAGDEOXTZPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c1-9-14(7)17(8,10-2)19-16(18)15(13(5)6)11-12(3)4/h11,14H,9-10H2,1-8H3.
What are the key properties of 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate?
3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate has a molecular weight of 266.42 g/mol, XLogP of 5.05, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylhexan-3-yl 4-methyl-2-propan-2-ylidenepent-3-enoate is sourced from PubChem (CID 89417553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).