C32H46N5O6PS2 — CID 89417974
6-[1-(4-diethoxyphosphorylbutylsulfonyl)-3,6-dihydro-2H-pyridin-4-yl]-2-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]oxy-1,3-benzothiazole (PubChem CID 89417974) has the molecular formula C32H46N5O6PS2 and a molecular weight of 691.86 g/mol. Its IUPAC name is 6-[1-(4-diethoxyphosphorylbutylsulfonyl)-3,6-dihydro-2H-pyridin-4-yl]-2-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]oxy-1,3-benzothiazole.
| Compound Name | 6-[1-(4-diethoxyphosphorylbutylsulfonyl)-3,6-dihydro-2H-pyridin-4-yl]-2-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]oxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 89417974 |
| Molecular Formula | C32H46N5O6PS2 |
| Molecular Weight | 691.86 g/mol |
| Exact Mass | 691.26 |
| IUPAC Name | 6-[1-(4-diethoxyphosphorylbutylsulfonyl)-3,6-dihydro-2H-pyridin-4-yl]-2-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]oxy-1,3-benzothiazole |
| SMILES | CCCc1cnc(N2CCC(Oc3nc4ccc(C5=CCN(S(=O)(=O)CCCCP(=O)(OCC)OCC)CC5)cc4s3)CC2)nc1 |
| InChI | InChI=1S/C32H46N5O6PS2/c1-4-9-25-23-33-31(34-24-25)36-16-14-28(15-17-36)43-32-35-29-11-10-27(22-30(29)45-32)26-12-18-37(19-13-26)46(39,40)21-8-7-20-44(38,41-5-2)42-6-3/h10-12,22-24,28H,4-9,13-21H2,1-3H3 |
| InChIKey | SUFXLCIXZOQNRD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 124.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.86 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|