About [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane
[(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane (PubChem CID 89418003) has the molecular formula C22H44OSi
and a molecular weight of 352.68 g/mol. Its IUPAC name is [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane |
| PubChem CID | 89418003 |
| Molecular Formula | C22H44OSi |
| Molecular Weight | 352.68 g/mol |
| Exact Mass | 352.32 |
| IUPAC Name | [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)=CCC/C(C)=C/CCCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H44OSi/c1-18(2)14-13-16-22(9)15-11-10-12-17-23-24(19(3)4,20(5)6)21(7)8/h14-15,19-21H,10-13,16-17H2,1-9H3/b22-15+ |
| InChIKey | YIPHCTXUMLQTPE-PXLXIMEGSA-N |
| XLogP | 8.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.68 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane?
The IUPAC name of [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane (CID 89418003) is [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane.
What is the SMILES notation for [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane?
The canonical SMILES for [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane is CC(C)=CCC/C(C)=C/CCCCO[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane?
The InChIKey is YIPHCTXUMLQTPE-PXLXIMEGSA-N. The full InChI is InChI=1S/C22H44OSi/c1-18(2)14-13-16-22(9)15-11-10-12-17-23-24(19(3)4,20(5)6)21(7)8/h14-15,19-21H,10-13,16-17H2,1-9H3/b22-15+.
What are the key properties of [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane?
[(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane has a molecular weight of 352.68 g/mol, XLogP of 8.04, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(5E)-6,10-dimethylundeca-5,9-dienoxy]-tri(propan-2-yl)silane is sourced from PubChem (CID 89418003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).