About (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine
(4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine (PubChem CID 89418548) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine |
| PubChem CID | 89418548 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine |
| SMILES | CCOC1=C(C)C=C(CN)CC1 |
| InChI | InChI=1S/C10H17NO/c1-3-12-10-5-4-9(7-11)6-8(10)2/h6H,3-5,7,11H2,1-2H3 |
| InChIKey | ANARUWLOVLZCGV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine?
The IUPAC name of (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine (CID 89418548) is (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine.
What is the SMILES notation for (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine?
The canonical SMILES for (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine is CCOC1=C(C)C=C(CN)CC1.
What is the InChIKey of (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine?
The InChIKey is ANARUWLOVLZCGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-3-12-10-5-4-9(7-11)6-8(10)2/h6H,3-5,7,11H2,1-2H3.
What are the key properties of (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine?
(4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine has a molecular weight of 167.25 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxy-3-methylcyclohexa-1,3-dien-1-yl)methanamine is sourced from PubChem (CID 89418548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).