About N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide
N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide (PubChem CID 894186) has the molecular formula C13H18N2O5S
and a molecular weight of 314.36 g/mol. Its IUPAC name is N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide |
| PubChem CID | 894186 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)NC2CC2)cc1OC |
| InChI | InChI=1S/C13H18N2O5S/c1-19-11-6-5-10(7-12(11)20-2)21(17,18)14-8-13(16)15-9-3-4-9/h5-7,9,14H,3-4,8H2,1-2H3,(H,15,16) |
| InChIKey | BJFFMNIVBSQGBB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide?
The IUPAC name of N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide (CID 894186) is N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide.
What is the SMILES notation for N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide?
The canonical SMILES for N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide is COc1ccc(S(=O)(=O)NCC(=O)NC2CC2)cc1OC.
What is the InChIKey of N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide?
The InChIKey is BJFFMNIVBSQGBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O5S/c1-19-11-6-5-10(7-12(11)20-2)21(17,18)14-8-13(16)15-9-3-4-9/h5-7,9,14H,3-4,8H2,1-2H3,(H,15,16).
What are the key properties of N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide?
N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide has a molecular weight of 314.36 g/mol, XLogP of 0.26, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-[(3,4-dimethoxyphenyl)sulfonylamino]acetamide is sourced from PubChem (CID 894186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).