About 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine
1,3-dihydropyrrolo[3,4-c]pyridin-2-amine (PubChem CID 89418615) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine.
Molecular Properties
| Compound Name | 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine |
| PubChem CID | 89418615 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine |
| SMILES | NN1Cc2ccncc2C1 |
| InChI | InChI=1S/C7H9N3/c8-10-4-6-1-2-9-3-7(6)5-10/h1-3H,4-5,8H2 |
| InChIKey | VTGIQPVNAZMENQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine?
The IUPAC name of 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine (CID 89418615) is 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine.
What is the SMILES notation for 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine?
The canonical SMILES for 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine is NN1Cc2ccncc2C1.
What is the InChIKey of 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine?
The InChIKey is VTGIQPVNAZMENQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c8-10-4-6-1-2-9-3-7(6)5-10/h1-3H,4-5,8H2.
What are the key properties of 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine?
1,3-dihydropyrrolo[3,4-c]pyridin-2-amine has a molecular weight of 135.17 g/mol, XLogP of 0.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydropyrrolo[3,4-c]pyridin-2-amine is sourced from PubChem (CID 89418615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).