About prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate
prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate (PubChem CID 89418662) has the molecular formula C25H24N4O2S2
and a molecular weight of 476.63 g/mol. Its IUPAC name is prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate |
| PubChem CID | 89418662 |
| Molecular Formula | C25H24N4O2S2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate |
| SMILES | C=C(C)OC(=O)N1CCC(Sc2ccc3nccc(Nc4ccc5scnc5c4)c3c2)CC1 |
| InChI | InChI=1S/C25H24N4O2S2/c1-16(2)31-25(30)29-11-8-18(9-12-29)33-19-4-5-21-20(14-19)22(7-10-26-21)28-17-3-6-24-23(13-17)27-15-32-24/h3-7,10,13-15,18H,1,8-9,11-12H2,2H3,(H,26,28) |
| InChIKey | NTPYVMNIECXEHI-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate?
The IUPAC name of prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate (CID 89418662) is prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate.
What is the SMILES notation for prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate?
The canonical SMILES for prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate is C=C(C)OC(=O)N1CCC(Sc2ccc3nccc(Nc4ccc5scnc5c4)c3c2)CC1.
What is the InChIKey of prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate?
The InChIKey is NTPYVMNIECXEHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N4O2S2/c1-16(2)31-25(30)29-11-8-18(9-12-29)33-19-4-5-21-20(14-19)22(7-10-26-21)28-17-3-6-24-23(13-17)27-15-32-24/h3-7,10,13-15,18H,1,8-9,11-12H2,2H3,(H,26,28).
What are the key properties of prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate?
prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate has a molecular weight of 476.63 g/mol, XLogP of 6.81, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-yl 4-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfanylpiperidine-1-carboxylate is sourced from PubChem (CID 89418662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).