C26H27NO5 — CID 89418807
ethyl 7-formyl-9-[(4-methoxyphenyl)methyl]-5,5-dimethyl-8-oxo-6,7-dihydrocarbazole-3-carboxylate (PubChem CID 89418807) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is ethyl 7-formyl-9-[(4-methoxyphenyl)methyl]-5,5-dimethyl-8-oxo-6,7-dihydrocarbazole-3-carboxylate.
| Compound Name | ethyl 7-formyl-9-[(4-methoxyphenyl)methyl]-5,5-dimethyl-8-oxo-6,7-dihydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 89418807 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | ethyl 7-formyl-9-[(4-methoxyphenyl)methyl]-5,5-dimethyl-8-oxo-6,7-dihydrocarbazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c1c(n2Cc2ccc(OC)cc2)C(=O)C(C=O)CC1(C)C |
| InChI | InChI=1S/C26H27NO5/c1-5-32-25(30)17-8-11-21-20(12-17)22-23(24(29)18(15-28)13-26(22,2)3)27(21)14-16-6-9-19(31-4)10-7-16/h6-12,15,18H,5,13-14H2,1-4H3 |
| InChIKey | BXACFGPQOPJKQC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|