C18H24F2N2 — CID 89419005
(2E,6E)-2-fluoro-9-(2-fluorocyclohexa-1,5-dien-1-yl)-1-imino-5,5-dimethyl-4-methylidenenona-2,6-dien-3-amine (PubChem CID 89419005) has the molecular formula C18H24F2N2 and a molecular weight of 306.40 g/mol. Its IUPAC name is (2E,6E)-2-fluoro-9-(2-fluorocyclohexa-1,5-dien-1-yl)-1-imino-5,5-dimethyl-4-methylidenenona-2,6-dien-3-amine.
| Compound Name | (2E,6E)-2-fluoro-9-(2-fluorocyclohexa-1,5-dien-1-yl)-1-imino-5,5-dimethyl-4-methylidenenona-2,6-dien-3-amine |
|---|---|
| PubChem CID | 89419005 |
| Molecular Formula | C18H24F2N2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2E,6E)-2-fluoro-9-(2-fluorocyclohexa-1,5-dien-1-yl)-1-imino-5,5-dimethyl-4-methylidenenona-2,6-dien-3-amine |
| SMILES | [H]/N=C/C(F)=C(\N)C(=C)C(C)(C)/C=C/CCC1=C(F)CCC=C1 |
| InChI | InChI=1S/C18H24F2N2/c1-13(17(22)16(20)12-21)18(2,3)11-7-6-9-14-8-4-5-10-15(14)19/h4,7-8,11-12,21H,1,5-6,9-10,22H2,2-3H3/b11-7+,17-16+,21-12+ |
| InChIKey | IEELAXHQLXZCCE-HTUCEQADSA-N |
| XLogP | 5.27 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|