About 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine
4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine (PubChem CID 89419044) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine.
Molecular Properties
| Compound Name | 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine |
| PubChem CID | 89419044 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine |
| SMILES | CC(C)C1=CCN(N)CC1 |
| InChI | InChI=1S/C8H16N2/c1-7(2)8-3-5-10(9)6-4-8/h3,7H,4-6,9H2,1-2H3 |
| InChIKey | GYNFFHYMAGEGPN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine?
The IUPAC name of 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine (CID 89419044) is 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine.
What is the SMILES notation for 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine?
The canonical SMILES for 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine is CC(C)C1=CCN(N)CC1.
What is the InChIKey of 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine?
The InChIKey is GYNFFHYMAGEGPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-7(2)8-3-5-10(9)6-4-8/h3,7H,4-6,9H2,1-2H3.
What are the key properties of 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine?
4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine has a molecular weight of 140.23 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine is sourced from PubChem (CID 89419044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).