C10H11F — CID 89419046
(4Z,6E)-4-ethynyl-7-fluoroocta-1,4,6-triene (PubChem CID 89419046) has the molecular formula C10H11F and a molecular weight of 150.20 g/mol. Its IUPAC name is (4Z,6E)-4-ethynyl-7-fluoroocta-1,4,6-triene.
| Compound Name | (4Z,6E)-4-ethynyl-7-fluoroocta-1,4,6-triene |
|---|---|
| PubChem CID | 89419046 |
| Molecular Formula | C10H11F |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (4Z,6E)-4-ethynyl-7-fluoroocta-1,4,6-triene |
| SMILES | C#C/C(=C\C=C(/C)F)CC=C |
| InChI | InChI=1S/C10H11F/c1-4-6-10(5-2)8-7-9(3)11/h2,4,7-8H,1,6H2,3H3/b9-7+,10-8+ |
| InChIKey | MLKWYUNJNPQKQJ-FIFLTTCUSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|