C32H40IN3O — CID 89419360
N,N-diethyl-4-[[(2S,5R)-4-[[3-(iodomethyl)phenyl]methyl]-2,5-dimethylpiperazin-1-yl]-phenylmethyl]benzamide (PubChem CID 89419360) has the molecular formula C32H40IN3O and a molecular weight of 609.60 g/mol. Its IUPAC name is N,N-diethyl-4-[[(2S,5R)-4-[[3-(iodomethyl)phenyl]methyl]-2,5-dimethylpiperazin-1-yl]-phenylmethyl]benzamide.
| Compound Name | N,N-diethyl-4-[[(2S,5R)-4-[[3-(iodomethyl)phenyl]methyl]-2,5-dimethylpiperazin-1-yl]-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 89419360 |
| Molecular Formula | C32H40IN3O |
| Molecular Weight | 609.60 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | N,N-diethyl-4-[[(2S,5R)-4-[[3-(iodomethyl)phenyl]methyl]-2,5-dimethylpiperazin-1-yl]-phenylmethyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(c2ccccc2)N2C[C@@H](C)N(Cc3cccc(CI)c3)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C32H40IN3O/c1-5-34(6-2)32(37)30-17-15-29(16-18-30)31(28-13-8-7-9-14-28)36-22-24(3)35(21-25(36)4)23-27-12-10-11-26(19-27)20-33/h7-19,24-25,31H,5-6,20-23H2,1-4H3/t24-,25+,31?/m1/s1 |
| InChIKey | JNMTWTQUWKEFBO-HVFKJYJOSA-N |
| XLogP | 6.79 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|