About (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine
(E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine (PubChem CID 89419654) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine.
Molecular Properties
| Compound Name | (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine |
| PubChem CID | 89419654 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine |
| SMILES | C=C=C(C)/N=C/C(C)=C(\C)N |
| InChI | InChI=1S/C9H14N2/c1-5-8(3)11-6-7(2)9(4)10/h6H,1,10H2,2-4H3/b9-7+,11-6+ |
| InChIKey | WNBTUAWVUBVKGE-HHGGOTJKSA-N |
| XLogP | 2.00 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine?
The IUPAC name of (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine (CID 89419654) is (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine.
What is the SMILES notation for (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine?
The canonical SMILES for (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine is C=C=C(C)/N=C/C(C)=C(\C)N.
What is the InChIKey of (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine?
The InChIKey is WNBTUAWVUBVKGE-HHGGOTJKSA-N. The full InChI is InChI=1S/C9H14N2/c1-5-8(3)11-6-7(2)9(4)10/h6H,1,10H2,2-4H3/b9-7+,11-6+.
What are the key properties of (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine?
(E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine has a molecular weight of 150.22 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-buta-2,3-dien-2-ylimino-3-methylbut-2-en-2-amine is sourced from PubChem (CID 89419654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).