C30H53N3O11 — CID 89419679
N-[4-[2,2-bis[[3-hydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]butoxy]butoxymethyl]prop-2-enamide (PubChem CID 89419679) has the molecular formula C30H53N3O11 and a molecular weight of 631.76 g/mol. Its IUPAC name is N-[4-[2,2-bis[[3-hydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]butoxy]butoxymethyl]prop-2-enamide.
| Compound Name | N-[4-[2,2-bis[[3-hydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]butoxy]butoxymethyl]prop-2-enamide |
|---|---|
| PubChem CID | 89419679 |
| Molecular Formula | C30H53N3O11 |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.37 |
| IUPAC Name | N-[4-[2,2-bis[[3-hydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]butoxy]butoxymethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCOCCCCOCC(CC)(COCCC(O)COCNC(=O)C=C)COCCC(O)COCNC(=O)C=C |
| InChI | InChI=1S/C30H53N3O11/c1-5-27(36)31-22-42-14-10-9-13-39-19-30(8-4,20-40-15-11-25(34)17-43-23-32-28(37)6-2)21-41-16-12-26(35)18-44-24-33-29(38)7-3/h5-7,25-26,34-35H,1-3,8-24H2,4H3,(H,31,36)(H,32,37)(H,33,38) |
| InChIKey | UHQJWJSDWBYVEJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 183.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|