C36H6F14OS2 — CID 89419735
2,6-bis(1,2,3,6,7,8,9-heptafluorodibenzothiophen-4-yl)dibenzofuran (PubChem CID 89419735) has the molecular formula C36H6F14OS2 and a molecular weight of 784.55 g/mol. Its IUPAC name is 2,6-bis(1,2,3,6,7,8,9-heptafluorodibenzothiophen-4-yl)dibenzofuran.
| Compound Name | 2,6-bis(1,2,3,6,7,8,9-heptafluorodibenzothiophen-4-yl)dibenzofuran |
|---|---|
| PubChem CID | 89419735 |
| Molecular Formula | C36H6F14OS2 |
| Molecular Weight | 784.55 g/mol |
| Exact Mass | 783.96 |
| IUPAC Name | 2,6-bis(1,2,3,6,7,8,9-heptafluorodibenzothiophen-4-yl)dibenzofuran |
| SMILES | Fc1c(F)c(F)c2c(sc3c(-c4ccc5oc6c(-c7c(F)c(F)c(F)c8c7sc7c(F)c(F)c(F)c(F)c78)cccc6c5c4)c(F)c(F)c(F)c32)c1F |
| InChI | InChI=1S/C36H6F14OS2/c37-18-12(33-14(20(39)24(18)43)16-22(41)26(45)28(47)30(49)35(16)52-33)7-4-5-11-10(6-7)8-2-1-3-9(32(8)51-11)13-19(38)25(44)21(40)15-17-23(42)27(46)29(48)31(50)36(17)53-34(13)15/h1-6H |
| InChIKey | TVTRAKBSOKLWAM-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.55 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|