About (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid
(2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid (PubChem CID 89419772) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid.
Molecular Properties
| Compound Name | (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid |
| PubChem CID | 89419772 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid |
| SMILES | C=N[C@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C7H13NO2/c1-7(2,3)5(8-4)6(9)10/h5H,4H2,1-3H3,(H,9,10)/t5-/m1/s1 |
| InChIKey | HEEXKBXJISBYJK-RXMQYKEDSA-N |
| XLogP | 1.19 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid?
The IUPAC name of (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid (CID 89419772) is (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid.
What is the SMILES notation for (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid?
The canonical SMILES for (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid is C=N[C@H](C(=O)O)C(C)(C)C.
What is the InChIKey of (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid?
The InChIKey is HEEXKBXJISBYJK-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H13NO2/c1-7(2,3)5(8-4)6(9)10/h5H,4H2,1-3H3,(H,9,10)/t5-/m1/s1.
What are the key properties of (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid?
(2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid has a molecular weight of 143.19 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,3-dimethyl-2-(methylideneamino)butanoic acid is sourced from PubChem (CID 89419772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).