About 5-methyl-2-prop-2-enyl-2,3-dihydropyridine
5-methyl-2-prop-2-enyl-2,3-dihydropyridine (PubChem CID 89419790) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 5-methyl-2-prop-2-enyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 5-methyl-2-prop-2-enyl-2,3-dihydropyridine |
| PubChem CID | 89419790 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 5-methyl-2-prop-2-enyl-2,3-dihydropyridine |
| SMILES | C=CCC1CC=C(C)C=N1 |
| InChI | InChI=1S/C9H13N/c1-3-4-9-6-5-8(2)7-10-9/h3,5,7,9H,1,4,6H2,2H3 |
| InChIKey | NTPZQKAATZBQLK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-prop-2-enyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-prop-2-enyl-2,3-dihydropyridine?
The IUPAC name of 5-methyl-2-prop-2-enyl-2,3-dihydropyridine (CID 89419790) is 5-methyl-2-prop-2-enyl-2,3-dihydropyridine.
What is the SMILES notation for 5-methyl-2-prop-2-enyl-2,3-dihydropyridine?
The canonical SMILES for 5-methyl-2-prop-2-enyl-2,3-dihydropyridine is C=CCC1CC=C(C)C=N1.
What is the InChIKey of 5-methyl-2-prop-2-enyl-2,3-dihydropyridine?
The InChIKey is NTPZQKAATZBQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-3-4-9-6-5-8(2)7-10-9/h3,5,7,9H,1,4,6H2,2H3.
What are the key properties of 5-methyl-2-prop-2-enyl-2,3-dihydropyridine?
5-methyl-2-prop-2-enyl-2,3-dihydropyridine has a molecular weight of 135.21 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-prop-2-enyl-2,3-dihydropyridine is sourced from PubChem (CID 89419790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).