About (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine
(6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine (PubChem CID 89419828) has the molecular formula C13H16FN3O2S
and a molecular weight of 297.36 g/mol. Its IUPAC name is (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine.
Molecular Properties
| Compound Name | (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine |
| PubChem CID | 89419828 |
| Molecular Formula | C13H16FN3O2S |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine |
| SMILES | C[C@@]1(c2cc(N)ccc2F)CS(=O)(=O)C2(CC2)C(N)=N1 |
| InChI | InChI=1S/C13H16FN3O2S/c1-12(9-6-8(15)2-3-10(9)14)7-20(18,19)13(4-5-13)11(16)17-12/h2-3,6H,4-5,7,15H2,1H3,(H2,16,17)/t12-/m0/s1 |
| InChIKey | KTPOWCHYJRYHCA-LBPRGKRZSA-N |
| XLogP | 0.94 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine?
The IUPAC name of (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine (CID 89419828) is (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine.
What is the SMILES notation for (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine?
The canonical SMILES for (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine is C[C@@]1(c2cc(N)ccc2F)CS(=O)(=O)C2(CC2)C(N)=N1.
What is the InChIKey of (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine?
The InChIKey is KTPOWCHYJRYHCA-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H16FN3O2S/c1-12(9-6-8(15)2-3-10(9)14)7-20(18,19)13(4-5-13)11(16)17-12/h2-3,6H,4-5,7,15H2,1H3,(H2,16,17)/t12-/m0/s1.
What are the key properties of (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine?
(6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine has a molecular weight of 297.36 g/mol, XLogP of 0.94, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-(5-amino-2-fluorophenyl)-6-methyl-4,4-dioxo-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine is sourced from PubChem (CID 89419828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).