C20H30F4 — CID 89419945
1,2,4,5-tetrafluoro-3,6-bis(3-methylhexan-3-yl)benzene (PubChem CID 89419945) has the molecular formula C20H30F4 and a molecular weight of 346.45 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-bis(3-methylhexan-3-yl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3,6-bis(3-methylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 89419945 |
| Molecular Formula | C20H30F4 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-bis(3-methylhexan-3-yl)benzene |
| SMILES | CCCC(C)(CC)c1c(F)c(F)c(C(C)(CC)CCC)c(F)c1F |
| InChI | InChI=1S/C20H30F4/c1-7-11-19(5,9-3)13-15(21)17(23)14(18(24)16(13)22)20(6,10-4)12-8-2/h7-12H2,1-6H3 |
| InChIKey | QFXXQUHCANZGRO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|