C12H14FN3O2 — CID 89420043
(3E,5E)-7-(4-amino-5-fluoropyrimidin-2-yl)oxy-6-methylhepta-1,3,5-trien-3-ol (PubChem CID 89420043) has the molecular formula C12H14FN3O2 and a molecular weight of 251.26 g/mol. Its IUPAC name is (3E,5E)-7-(4-amino-5-fluoropyrimidin-2-yl)oxy-6-methylhepta-1,3,5-trien-3-ol.
| Compound Name | (3E,5E)-7-(4-amino-5-fluoropyrimidin-2-yl)oxy-6-methylhepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 89420043 |
| Molecular Formula | C12H14FN3O2 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (3E,5E)-7-(4-amino-5-fluoropyrimidin-2-yl)oxy-6-methylhepta-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C\C=C(/C)COc1ncc(F)c(N)n1 |
| InChI | InChI=1S/C12H14FN3O2/c1-3-9(17)5-4-8(2)7-18-12-15-6-10(13)11(14)16-12/h3-6,17H,1,7H2,2H3,(H2,14,15,16)/b8-4+,9-5+ |
| InChIKey | QQUFFZVFCIYVLA-KBXRYBNXSA-N |
| XLogP | 2.15 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|