C20H20ClNO4S — CID 89420442
[5-[3-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(2-pyridin-3-ylethynyl)cyclopentyl]propyl]thiophen-2-yl] hydrogen carbonate (PubChem CID 89420442) has the molecular formula C20H20ClNO4S and a molecular weight of 405.90 g/mol. Its IUPAC name is [5-[3-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(2-pyridin-3-ylethynyl)cyclopentyl]propyl]thiophen-2-yl] hydrogen carbonate.
| Compound Name | [5-[3-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(2-pyridin-3-ylethynyl)cyclopentyl]propyl]thiophen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 89420442 |
| Molecular Formula | C20H20ClNO4S |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [5-[3-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(2-pyridin-3-ylethynyl)cyclopentyl]propyl]thiophen-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc(CCC[C@@H]2[C@@H](C#Cc3cccnc3)[C@H](O)C[C@H]2Cl)s1 |
| InChI | InChI=1S/C20H20ClNO4S/c21-17-11-18(23)16(8-6-13-3-2-10-22-12-13)15(17)5-1-4-14-7-9-19(27-14)26-20(24)25/h2-3,7,9-10,12,15-18,23H,1,4-5,11H2,(H,24,25)/t15-,16-,17-,18-/m1/s1 |
| InChIKey | PMUQCRMDFAVWAU-BRSBDYLESA-N |
| XLogP | 4.18 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|