C11H17F9OSi — CID 89420830
dimethyl-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)-propan-2-yloxysilane (PubChem CID 89420830) has the molecular formula C11H17F9OSi and a molecular weight of 364.32 g/mol. Its IUPAC name is dimethyl-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)-propan-2-yloxysilane.
| Compound Name | dimethyl-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)-propan-2-yloxysilane |
|---|---|
| PubChem CID | 89420830 |
| Molecular Formula | C11H17F9OSi |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | dimethyl-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)-propan-2-yloxysilane |
| SMILES | CC(C)O[Si](C)(C)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C11H17F9OSi/c1-7(2)21-22(3,4)11(19,20)10(17,18)8(12,13)5-6-9(14,15)16/h7H,5-6H2,1-4H3 |
| InChIKey | QKVZRZQDEQZRDO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|