C8H12N2O — CID 89420960
trans-(1R,3R)-3-cyanocyclohexane-1-carboxamide (PubChem CID 89420960) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is trans-(1R,3R)-3-cyanocyclohexane-1-carboxamide.
| Compound Name | trans-(1R,3R)-3-cyanocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 89420960 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | trans-(1R,3R)-3-cyanocyclohexane-1-carboxamide |
| SMILES | N#C[C@@H]1CCC[C@@H](C(N)=O)C1 |
| InChI | InChI=1S/C8H12N2O/c9-5-6-2-1-3-7(4-6)8(10)11/h6-7H,1-4H2,(H2,10,11)/t6-,7-/m1/s1 |
| InChIKey | RKOSPWTUNHTVCE-RNFRBKRXSA-N |
| XLogP | 0.80 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |