C21H22O5S — CID 89420990
[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenyl] 3-methylsulfanylpropanoate (PubChem CID 89420990) has the molecular formula C21H22O5S and a molecular weight of 386.47 g/mol. Its IUPAC name is [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenyl] 3-methylsulfanylpropanoate.
| Compound Name | [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenyl] 3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 89420990 |
| Molecular Formula | C21H22O5S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenyl] 3-methylsulfanylpropanoate |
| SMILES | COc1ccc(-c2ccc3c(c2)CCC3=O)c(OC(=O)CCSC)c1OC |
| InChI | InChI=1S/C21H22O5S/c1-24-18-9-7-16(14-4-6-15-13(12-14)5-8-17(15)22)20(21(18)25-2)26-19(23)10-11-27-3/h4,6-7,9,12H,5,8,10-11H2,1-3H3 |
| InChIKey | RUHJFBVJGRIDTB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|