About N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide
N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide (PubChem CID 89421101) has the molecular formula C7H13F3N2O2
and a molecular weight of 214.19 g/mol. Its IUPAC name is N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide.
Molecular Properties
| Compound Name | N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide |
| PubChem CID | 89421101 |
| Molecular Formula | C7H13F3N2O2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide |
| SMILES | C[C@@H](N)CN(CCO)C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O2/c1-5(11)4-12(2-3-13)6(14)7(8,9)10/h5,13H,2-4,11H2,1H3/t5-/m1/s1 |
| InChIKey | KRAMFQQHOBONGG-RXMQYKEDSA-N |
| XLogP | -0.28 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide?
The IUPAC name of N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide (CID 89421101) is N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide.
What is the SMILES notation for N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide?
The canonical SMILES for N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide is C[C@@H](N)CN(CCO)C(=O)C(F)(F)F.
What is the InChIKey of N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide?
The InChIKey is KRAMFQQHOBONGG-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H13F3N2O2/c1-5(11)4-12(2-3-13)6(14)7(8,9)10/h5,13H,2-4,11H2,1H3/t5-/m1/s1.
What are the key properties of N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide?
N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide has a molecular weight of 214.19 g/mol, XLogP of -0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-aminopropyl]-2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide is sourced from PubChem (CID 89421101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).