About N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide
N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide (PubChem CID 89421449) has the molecular formula C16H10ClIN2O3
and a molecular weight of 440.62 g/mol. Its IUPAC name is N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide.
Molecular Properties
| Compound Name | N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide |
| PubChem CID | 89421449 |
| Molecular Formula | C16H10ClIN2O3 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 439.94 |
| IUPAC Name | N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide |
| SMILES | CC(=O)N(Cl)c1c(I)cc2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H10ClIN2O3/c1-7(21)20(17)14-11(18)6-10-12(13(14)19)16(23)9-5-3-2-4-8(9)15(10)22/h2-6H,19H2,1H3 |
| InChIKey | CYBXFMOVCXLWMM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide?
The IUPAC name of N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide (CID 89421449) is N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide.
What is the SMILES notation for N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide?
The canonical SMILES for N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide is CC(=O)N(Cl)c1c(I)cc2c(c1N)C(=O)c1ccccc1C2=O.
What is the InChIKey of N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide?
The InChIKey is CYBXFMOVCXLWMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClIN2O3/c1-7(21)20(17)14-11(18)6-10-12(13(14)19)16(23)9-5-3-2-4-8(9)15(10)22/h2-6H,19H2,1H3.
What are the key properties of N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide?
N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide has a molecular weight of 440.62 g/mol, XLogP of 3.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-3-iodo-9,10-dioxoanthracen-2-yl)-N-chloroacetamide is sourced from PubChem (CID 89421449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).