About cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium
cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium (PubChem CID 89421463) has the molecular formula C10H11F3N3OS+
and a molecular weight of 278.28 g/mol. Its IUPAC name is cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium.
Molecular Properties
| Compound Name | cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium |
| PubChem CID | 89421463 |
| Molecular Formula | C10H11F3N3OS+ |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium |
| SMILES | CC/S(O)=[N+](/C#N)Cc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C10H10F3N3OS/c1-2-18(17)16(7-14)6-8-3-4-9(15-5-8)10(11,12)13/h3-5H,2,6H2,1H3/p+1 |
| InChIKey | WUZAUMRXHKJYAS-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium?
The IUPAC name of cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium (CID 89421463) is cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium.
What is the SMILES notation for cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium?
The canonical SMILES for cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium is CC/S(O)=[N+](/C#N)Cc1ccc(C(F)(F)F)nc1.
What is the InChIKey of cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium?
The InChIKey is WUZAUMRXHKJYAS-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H10F3N3OS/c1-2-18(17)16(7-14)6-8-3-4-9(15-5-8)10(11,12)13/h3-5H,2,6H2,1H3/p+1.
What are the key properties of cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium?
cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium has a molecular weight of 278.28 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyano-[ethyl(hydroxy)-λ4-sulfanylidene]-[[6-(trifluoromethyl)-3-pyridinyl]methyl]azanium is sourced from PubChem (CID 89421463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).