C31H53N5O2 — CID 89421590
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[(2S)-1-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-1-oxopropan-2-yl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 89421590) has the molecular formula C31H53N5O2 and a molecular weight of 527.80 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[(2S)-1-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-1-oxopropan-2-yl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[(2S)-1-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-1-oxopropan-2-yl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 89421590 |
| Molecular Formula | C31H53N5O2 |
| Molecular Weight | 527.80 g/mol |
| Exact Mass | 527.42 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[(2S)-1-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-1-oxopropan-2-yl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N[C@@H](C)C(=O)NCCNCCNCCN |
| InChI | InChI=1S/C31H53N5O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-30(37)36-29(2)31(38)35-28-27-34-26-25-33-24-23-32/h4-5,7-8,10-11,13-14,16-17,19-20,29,33-34H,3,6,9,12,15,18,21-28,32H2,1-2H3,(H,35,38)(H,36,37)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-/t29-/m0/s1 |
| InChIKey | CEINHWMMKHHSTM-NPOYHQMSSA-N |
| XLogP | 4.22 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.80 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|