C21H18ClF3N3O5S2- — CID 89421904
2-chloro-7-[2,3,6-trifluoro-5-[3-propylsulfonylpropyl(sulfinato)amino]benzoyl]quinoxaline (PubChem CID 89421904) has the molecular formula C21H18ClF3N3O5S2- and a molecular weight of 548.97 g/mol. Its IUPAC name is 2-chloro-7-[2,3,6-trifluoro-5-[3-propylsulfonylpropyl(sulfinato)amino]benzoyl]quinoxaline.
| Compound Name | 2-chloro-7-[2,3,6-trifluoro-5-[3-propylsulfonylpropyl(sulfinato)amino]benzoyl]quinoxaline |
|---|---|
| PubChem CID | 89421904 |
| Molecular Formula | C21H18ClF3N3O5S2- |
| Molecular Weight | 548.97 g/mol |
| Exact Mass | 548.03 |
| IUPAC Name | 2-chloro-7-[2,3,6-trifluoro-5-[3-propylsulfonylpropyl(sulfinato)amino]benzoyl]quinoxaline |
| SMILES | CCCS(=O)(=O)CCCN(c1cc(F)c(F)c(C(=O)c2ccc3ncc(Cl)nc3c2)c1F)S(=O)[O-] |
| InChI | InChI=1S/C21H19ClF3N3O5S2/c1-2-7-35(32,33)8-3-6-28(34(30)31)16-10-13(23)19(24)18(20(16)25)21(29)12-4-5-14-15(9-12)27-17(22)11-26-14/h4-5,9-11H,2-3,6-8H2,1H3,(H,30,31)/p-1 |
| InChIKey | MRIOIWFMEVAUIR-UHFFFAOYSA-M |
| XLogP | 3.75 |
| TPSA | 120.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.97 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|