C20H6F10N2O2 — CID 89422005
2,3-bis(2,3,4,5,6-pentafluorophenyl)benzene-1,4-dicarboxamide (PubChem CID 89422005) has the molecular formula C20H6F10N2O2 and a molecular weight of 496.26 g/mol. Its IUPAC name is 2,3-bis(2,3,4,5,6-pentafluorophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 2,3-bis(2,3,4,5,6-pentafluorophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 89422005 |
| Molecular Formula | C20H6F10N2O2 |
| Molecular Weight | 496.26 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 2,3-bis(2,3,4,5,6-pentafluorophenyl)benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)c(-c2c(F)c(F)c(F)c(F)c2F)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H6F10N2O2/c21-9-7(10(22)14(26)17(29)13(9)25)5-3(19(31)33)1-2-4(20(32)34)6(5)8-11(23)15(27)18(30)16(28)12(8)24/h1-2H,(H2,31,33)(H2,32,34) |
| InChIKey | DXINYMLAGRBKNB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|