C22H17F3N5O3S- — CID 89423323
2-(5-methylimidazol-1-yl)-7-[2,3,6-trifluoro-5-[3-(sulfinatoamino)propyl]benzoyl]quinoxaline (PubChem CID 89423323) has the molecular formula C22H17F3N5O3S- and a molecular weight of 488.47 g/mol. Its IUPAC name is 2-(5-methylimidazol-1-yl)-7-[2,3,6-trifluoro-5-[3-(sulfinatoamino)propyl]benzoyl]quinoxaline.
| Compound Name | 2-(5-methylimidazol-1-yl)-7-[2,3,6-trifluoro-5-[3-(sulfinatoamino)propyl]benzoyl]quinoxaline |
|---|---|
| PubChem CID | 89423323 |
| Molecular Formula | C22H17F3N5O3S- |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 2-(5-methylimidazol-1-yl)-7-[2,3,6-trifluoro-5-[3-(sulfinatoamino)propyl]benzoyl]quinoxaline |
| SMILES | Cc1cncn1-c1cnc2ccc(C(=O)c3c(F)c(F)cc(CCCNS(=O)[O-])c3F)cc2n1 |
| InChI | InChI=1S/C22H18F3N5O3S/c1-12-9-26-11-30(12)18-10-27-16-5-4-14(8-17(16)29-18)22(31)19-20(24)13(7-15(23)21(19)25)3-2-6-28-34(32)33/h4-5,7-11,28H,2-3,6H2,1H3,(H,32,33)/p-1 |
| InChIKey | YGLDVVMPNURDKB-UHFFFAOYSA-M |
| XLogP | 3.09 |
| TPSA | 112.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|